C16H20F3N3 — CID 83984111
N-[2-(1,2-dimethyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 83984111) has the molecular formula C16H20F3N3 and a molecular weight of 311.35 g/mol. Its IUPAC name is N-[2-(1,2-dimethyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(1,2-dimethyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 83984111 |
| Molecular Formula | C16H20F3N3 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[2-(1,2-dimethyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | Cc1c(CCNCC(F)(F)F)c2cc3c(cc2n1C)CNC3 |
| InChI | InChI=1S/C16H20F3N3/c1-10-13(3-4-20-9-16(17,18)19)14-5-11-7-21-8-12(11)6-15(14)22(10)2/h5-6,20-21H,3-4,7-9H2,1-2H3 |
| InChIKey | SOJBNSZHEQVGFR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|