C15H19N3O2 — CID 83984140
2-amino-2-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)acetic acid (PubChem CID 83984140) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-amino-2-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)acetic acid.
| Compound Name | 2-amino-2-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 83984140 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-amino-2-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)acetic acid |
| SMILES | CCn1c(C)c(C(N)C(=O)O)c2cc3c(cc21)CNC3 |
| InChI | InChI=1S/C15H19N3O2/c1-3-18-8(2)13(14(16)15(19)20)11-4-9-6-17-7-10(9)5-12(11)18/h4-5,14,17H,3,6-7,16H2,1-2H3,(H,19,20) |
| InChIKey | KBQJJCMQYMETPW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|