C18H24F3N3 — CID 83984164
1-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 83984164) has the molecular formula C18H24F3N3 and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | 1-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 83984164 |
| Molecular Formula | C18H24F3N3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-(1-ethyl-2-methyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | CCn1c(C)c(CC(C)NCC(F)(F)F)c2cc3c(cc21)CNC3 |
| InChI | InChI=1S/C18H24F3N3/c1-4-24-12(3)15(5-11(2)23-10-18(19,20)21)16-6-13-8-22-9-14(13)7-17(16)24/h6-7,11,22-23H,4-5,8-10H2,1-3H3 |
| InChIKey | ANLHKYPEYVITKY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|