C18H25N3O2 — CID 83984224
2-(methylamino)-3-(2-methyl-1-propyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)propanoic acid (PubChem CID 83984224) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-(methylamino)-3-(2-methyl-1-propyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)propanoic acid.
| Compound Name | 2-(methylamino)-3-(2-methyl-1-propyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 83984224 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-(methylamino)-3-(2-methyl-1-propyl-6,7-dihydro-5H-pyrrolo[3,4-f]indol-3-yl)propanoic acid |
| SMILES | CCCn1c(C)c(CC(NC)C(=O)O)c2cc3c(cc21)CNC3 |
| InChI | InChI=1S/C18H25N3O2/c1-4-5-21-11(2)14(8-16(19-3)18(22)23)15-6-12-9-20-10-13(12)7-17(15)21/h6-7,16,19-20H,4-5,8-10H2,1-3H3,(H,22,23) |
| InChIKey | XKQMUHDJBHYECD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|