C19H26N2O2 — CID 83984251
3-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoic acid (PubChem CID 83984251) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoic acid.
| Compound Name | 3-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83984251 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoic acid |
| SMILES | CCCn1c(C)c(CC(C)C(=O)O)c2cc3c(cc21)CN(C)C3 |
| InChI | InChI=1S/C19H26N2O2/c1-5-6-21-13(3)16(7-12(2)19(22)23)17-8-14-10-20(4)11-15(14)9-18(17)21/h8-9,12H,5-7,10-11H2,1-4H3,(H,22,23) |
| InChIKey | XJDUHDZICNVVEJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|