C17H25N3O — CID 83984420
2-amino-2-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)ethanol (PubChem CID 83984420) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-amino-2-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)ethanol.
| Compound Name | 2-amino-2-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)ethanol |
|---|---|
| PubChem CID | 83984420 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-amino-2-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)ethanol |
| SMILES | Cc1c(C(N)CO)c2cc3c(cc2n1C)CN(C(C)C)C3 |
| InChI | InChI=1S/C17H25N3O/c1-10(2)20-7-12-5-14-16(6-13(12)8-20)19(4)11(3)17(14)15(18)9-21/h5-6,10,15,21H,7-9,18H2,1-4H3 |
| InChIKey | VRHXNCMVXWSHLE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|