C19H29N3 — CID 83984429
3-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropan-1-amine (PubChem CID 83984429) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropan-1-amine.
| Compound Name | 3-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 83984429 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 3-(1,2-dimethyl-6-propan-2-yl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropan-1-amine |
| SMILES | Cc1c(CC(C)CN)c2cc3c(cc2n1C)CN(C(C)C)C3 |
| InChI | InChI=1S/C19H29N3/c1-12(2)22-10-15-7-18-17(6-13(3)9-20)14(4)21(5)19(18)8-16(15)11-22/h7-8,12-13H,6,9-11,20H2,1-5H3 |
| InChIKey | QZVKSWULRDNLGG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|