C17H21NO2 — CID 83984618
2-(5,6,7,8-tetrahydro-1H-benzo[f]indol-3-ylmethyl)butanoic acid (PubChem CID 83984618) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-1H-benzo[f]indol-3-ylmethyl)butanoic acid.
| Compound Name | 2-(5,6,7,8-tetrahydro-1H-benzo[f]indol-3-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 83984618 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-(5,6,7,8-tetrahydro-1H-benzo[f]indol-3-ylmethyl)butanoic acid |
| SMILES | CCC(Cc1c[nH]c2cc3c(cc12)CCCC3)C(=O)O |
| InChI | InChI=1S/C17H21NO2/c1-2-11(17(19)20)7-14-10-18-16-9-13-6-4-3-5-12(13)8-15(14)16/h8-11,18H,2-7H2,1H3,(H,19,20) |
| InChIKey | ZLCOTTLOSYDIJC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |