C19H25F3N2 — CID 83984742
1-(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 83984742) has the molecular formula C19H25F3N2 and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | 1-(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 83984742 |
| Molecular Formula | C19H25F3N2 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | Cc1[nH]c2cc3c(cc2c1CC(C)NCC(F)(F)F)CCCCC3 |
| InChI | InChI=1S/C19H25F3N2/c1-12(23-11-19(20,21)22)8-16-13(2)24-18-10-15-7-5-3-4-6-14(15)9-17(16)18/h9-10,12,23-24H,3-8,11H2,1-2H3 |
| InChIKey | VLSPETFZRKHRGJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|