C17H21F3N2 — CID 83984744
2,2,2-trifluoro-N-[(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)methyl]ethanamine (PubChem CID 83984744) has the molecular formula C17H21F3N2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)methyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 83984744 |
| Molecular Formula | C17H21F3N2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]indol-3-yl)methyl]ethanamine |
| SMILES | Cc1[nH]c2cc3c(cc2c1CNCC(F)(F)F)CCCCC3 |
| InChI | InChI=1S/C17H21F3N2/c1-11-15(9-21-10-17(18,19)20)14-7-12-5-3-2-4-6-13(12)8-16(14)22-11/h7-8,21-22H,2-6,9-10H2,1H3 |
| InChIKey | JSBVPBZEENZPRT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|