C18H17F2NO2 — CID 83985430
2-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-2-(methylamino)acetic acid (PubChem CID 83985430) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-2-(methylamino)acetic acid.
| Compound Name | 2-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 83985430 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-(6,13-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl)-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)C1c2ccc(F)cc2CCc2cc(F)ccc21 |
| InChI | InChI=1S/C18H17F2NO2/c1-21-17(18(22)23)16-14-6-4-12(19)8-10(14)2-3-11-9-13(20)5-7-15(11)16/h4-9,16-17,21H,2-3H2,1H3,(H,22,23) |
| InChIKey | DYRTWGFAQGPYSP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |