C15H21FN2O2 — CID 83986142
methyl 2-amino-3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]propanoate (PubChem CID 83986142) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is methyl 2-amino-3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]propanoate.
| Compound Name | methyl 2-amino-3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 83986142 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | methyl 2-amino-3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]propanoate |
| SMILES | COC(=O)C(N)CC1CCN(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H21FN2O2/c1-20-15(19)14(17)8-12-6-7-18(10-12)9-11-2-4-13(16)5-3-11/h2-5,12,14H,6-10,17H2,1H3 |
| InChIKey | FVBMKKZHBGOUNQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |