C13H15N3 — CID 83986251
9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-amine (PubChem CID 83986251) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-amine.
| Compound Name | 9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-amine |
|---|---|
| PubChem CID | 83986251 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-amine |
| SMILES | Nc1ccc2[nH]c3c(c2c1)C1CCN3CC1 |
| InChI | InChI=1S/C13H15N3/c14-9-1-2-11-10(7-9)12-8-3-5-16(6-4-8)13(12)15-11/h1-2,7-8,15H,3-6,14H2 |
| InChIKey | JLMMWFBDFYKEAH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|