C13H19FN2 — CID 83987267
2-(2-fluorophenyl)-2-piperidin-2-ylethanamine (PubChem CID 83987267) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-2-piperidin-2-ylethanamine.
| Compound Name | 2-(2-fluorophenyl)-2-piperidin-2-ylethanamine |
|---|---|
| PubChem CID | 83987267 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-(2-fluorophenyl)-2-piperidin-2-ylethanamine |
| SMILES | NCC(c1ccccc1F)C1CCCCN1 |
| InChI | InChI=1S/C13H19FN2/c14-12-6-2-1-5-10(12)11(9-15)13-7-3-4-8-16-13/h1-2,5-6,11,13,16H,3-4,7-9,15H2 |
| InChIKey | FQOKXSHRKZTYFN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |