C19H28ClN3 — CID 83987539
2-(5-chloro-1H-indol-3-yl)-2-[1-(2-methylpropyl)piperidin-2-yl]ethanamine (PubChem CID 83987539) has the molecular formula C19H28ClN3 and a molecular weight of 333.91 g/mol. Its IUPAC name is 2-(5-chloro-1H-indol-3-yl)-2-[1-(2-methylpropyl)piperidin-2-yl]ethanamine.
| Compound Name | 2-(5-chloro-1H-indol-3-yl)-2-[1-(2-methylpropyl)piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 83987539 |
| Molecular Formula | C19H28ClN3 |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-(5-chloro-1H-indol-3-yl)-2-[1-(2-methylpropyl)piperidin-2-yl]ethanamine |
| SMILES | CC(C)CN1CCCCC1C(CN)c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H28ClN3/c1-13(2)12-23-8-4-3-5-19(23)16(10-21)17-11-22-18-7-6-14(20)9-15(17)18/h6-7,9,11,13,16,19,22H,3-5,8,10,12,21H2,1-2H3 |
| InChIKey | MWGDGMXQIVGOMX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |