C12H27N3O — CID 83990763
1-[1-(2-aminoethyl)-5-(ethylamino)piperidin-3-yl]propan-1-ol (PubChem CID 83990763) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-[1-(2-aminoethyl)-5-(ethylamino)piperidin-3-yl]propan-1-ol.
| Compound Name | 1-[1-(2-aminoethyl)-5-(ethylamino)piperidin-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 83990763 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-[1-(2-aminoethyl)-5-(ethylamino)piperidin-3-yl]propan-1-ol |
| SMILES | CCNC1CC(C(O)CC)CN(CCN)C1 |
| InChI | InChI=1S/C12H27N3O/c1-3-12(16)10-7-11(14-4-2)9-15(8-10)6-5-13/h10-12,14,16H,3-9,13H2,1-2H3 |
| InChIKey | PBRLNGXEOZNSEV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |