C15H26N2O2 — CID 83991764
2-[1-cyclopentyl-5-(cyclopropylamino)piperidin-3-yl]acetic acid (PubChem CID 83991764) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[1-cyclopentyl-5-(cyclopropylamino)piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-cyclopentyl-5-(cyclopropylamino)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 83991764 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-[1-cyclopentyl-5-(cyclopropylamino)piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CC(NC2CC2)CN(C2CCCC2)C1 |
| InChI | InChI=1S/C15H26N2O2/c18-15(19)8-11-7-13(16-12-5-6-12)10-17(9-11)14-3-1-2-4-14/h11-14,16H,1-10H2,(H,18,19) |
| InChIKey | KJMDSMBCSGUIRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |