C11H21F3N2 — CID 83992094
1,5-diethyl-N-(2,2,2-trifluoroethyl)piperidin-3-amine (PubChem CID 83992094) has the molecular formula C11H21F3N2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1,5-diethyl-N-(2,2,2-trifluoroethyl)piperidin-3-amine.
| Compound Name | 1,5-diethyl-N-(2,2,2-trifluoroethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83992094 |
| Molecular Formula | C11H21F3N2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1,5-diethyl-N-(2,2,2-trifluoroethyl)piperidin-3-amine |
| SMILES | CCC1CC(NCC(F)(F)F)CN(CC)C1 |
| InChI | InChI=1S/C11H21F3N2/c1-3-9-5-10(7-16(4-2)6-9)15-8-11(12,13)14/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | WURIYKPGCAVOQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |