About 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid
1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid (PubChem CID 83992158) has the molecular formula C12H21F3N2O2
and a molecular weight of 282.31 g/mol. Its IUPAC name is 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid |
| PubChem CID | 83992158 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid |
| SMILES | CC(C)CN1CC(NCC(F)(F)F)CC(C(=O)O)C1 |
| InChI | InChI=1S/C12H21F3N2O2/c1-8(2)4-17-5-9(11(18)19)3-10(6-17)16-7-12(13,14)15/h8-10,16H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | RSBMBVAPYPGGCT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
The IUPAC name of 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid (CID 83992158) is 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid is CC(C)CN1CC(NCC(F)(F)F)CC(C(=O)O)C1.
What is the InChIKey of 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
The InChIKey is RSBMBVAPYPGGCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O2/c1-8(2)4-17-5-9(11(18)19)3-10(6-17)16-7-12(13,14)15/h8-10,16H,3-7H2,1-2H3,(H,18,19).
What are the key properties of 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid has a molecular weight of 282.31 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid is sourced from PubChem (CID 83992158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).