About 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide
3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide (PubChem CID 83992265) has the molecular formula C10H18F3N3O2
and a molecular weight of 269.27 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide |
| PubChem CID | 83992265 |
| Molecular Formula | C10H18F3N3O2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CC(CCO)CC(NCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3N3O2/c11-10(12,13)6-15-8-3-7(1-2-17)4-16(5-8)9(14)18/h7-8,15,17H,1-6H2,(H2,14,18) |
| InChIKey | VJAHPKNWRONVJJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide?
The IUPAC name of 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide (CID 83992265) is 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide.
What is the SMILES notation for 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide?
The canonical SMILES for 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide is NC(=O)N1CC(CCO)CC(NCC(F)(F)F)C1.
What is the InChIKey of 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide?
The InChIKey is VJAHPKNWRONVJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3O2/c11-10(12,13)6-15-8-3-7(1-2-17)4-16(5-8)9(14)18/h7-8,15,17H,1-6H2,(H2,14,18).
What are the key properties of 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide?
3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide has a molecular weight of 269.27 g/mol, XLogP of 0.29, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)piperidine-1-carboxamide is sourced from PubChem (CID 83992265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).