About methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate
methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate (PubChem CID 83992290) has the molecular formula C11H17F3N2O3
and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate |
| PubChem CID | 83992290 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CC(NCC(F)(F)F)CN(C(C)=O)C1 |
| InChI | InChI=1S/C11H17F3N2O3/c1-7(17)16-4-8(10(18)19-2)3-9(5-16)15-6-11(12,13)14/h8-9,15H,3-6H2,1-2H3 |
| InChIKey | ZYZBZULPWVFRIN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate?
The IUPAC name of methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate (CID 83992290) is methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate.
What is the SMILES notation for methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate?
The canonical SMILES for methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate is COC(=O)C1CC(NCC(F)(F)F)CN(C(C)=O)C1.
What is the InChIKey of methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate?
The InChIKey is ZYZBZULPWVFRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O3/c1-7(17)16-4-8(10(18)19-2)3-9(5-16)15-6-11(12,13)14/h8-9,15H,3-6H2,1-2H3.
What are the key properties of methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate?
methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate has a molecular weight of 282.26 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-acetyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylate is sourced from PubChem (CID 83992290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).