About 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid
1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid (PubChem CID 83992460) has the molecular formula C11H17F3N2O2
and a molecular weight of 266.26 g/mol. Its IUPAC name is 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid |
| PubChem CID | 83992460 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(NCC(F)(F)F)CN(C2CC2)C1 |
| InChI | InChI=1S/C11H17F3N2O2/c12-11(13,14)6-15-8-3-7(10(17)18)4-16(5-8)9-1-2-9/h7-9,15H,1-6H2,(H,17,18) |
| InChIKey | UJXXTJWMXUGWBY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
The IUPAC name of 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid (CID 83992460) is 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
The canonical SMILES for 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid is O=C(O)C1CC(NCC(F)(F)F)CN(C2CC2)C1.
What is the InChIKey of 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
The InChIKey is UJXXTJWMXUGWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O2/c12-11(13,14)6-15-8-3-7(10(17)18)4-16(5-8)9-1-2-9/h7-9,15H,1-6H2,(H,17,18).
What are the key properties of 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid?
1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid has a molecular weight of 266.26 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-5-(2,2,2-trifluoroethylamino)piperidine-3-carboxylic acid is sourced from PubChem (CID 83992460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).