C14H28F2N2 — CID 83992822
5-butyl-N-(2,2-difluoroethyl)-1-propylpiperidin-3-amine (PubChem CID 83992822) has the molecular formula C14H28F2N2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 5-butyl-N-(2,2-difluoroethyl)-1-propylpiperidin-3-amine.
| Compound Name | 5-butyl-N-(2,2-difluoroethyl)-1-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 83992822 |
| Molecular Formula | C14H28F2N2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 5-butyl-N-(2,2-difluoroethyl)-1-propylpiperidin-3-amine |
| SMILES | CCCCC1CC(NCC(F)F)CN(CCC)C1 |
| InChI | InChI=1S/C14H28F2N2/c1-3-5-6-12-8-13(17-9-14(15)16)11-18(10-12)7-4-2/h12-14,17H,3-11H2,1-2H3 |
| InChIKey | TVXDPVDMPJDJLM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |