About 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol
1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol (PubChem CID 83993398) has the molecular formula C11H22F2N2O2
and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol.
Molecular Properties
| Compound Name | 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol |
| PubChem CID | 83993398 |
| Molecular Formula | C11H22F2N2O2 |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol |
| SMILES | CC(O)C1CC(NCC(F)F)CN(CCO)C1 |
| InChI | InChI=1S/C11H22F2N2O2/c1-8(17)9-4-10(14-5-11(12)13)7-15(6-9)2-3-16/h8-11,14,16-17H,2-7H2,1H3 |
| InChIKey | SJGIQYMEWWIJIV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol?
The IUPAC name of 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol (CID 83993398) is 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol.
What is the SMILES notation for 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol?
The canonical SMILES for 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol is CC(O)C1CC(NCC(F)F)CN(CCO)C1.
What is the InChIKey of 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol?
The InChIKey is SJGIQYMEWWIJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2O2/c1-8(17)9-4-10(14-5-11(12)13)7-15(6-9)2-3-16/h8-11,14,16-17H,2-7H2,1H3.
What are the key properties of 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol?
1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol has a molecular weight of 252.30 g/mol, XLogP of -0.10, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,2-difluoroethylamino)-1-(2-hydroxyethyl)piperidin-3-yl]ethanol is sourced from PubChem (CID 83993398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).