C11H14Cl3N3OS — CID 839935
2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl]propanamide (PubChem CID 839935) has the molecular formula C11H14Cl3N3OS and a molecular weight of 342.68 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl]propanamide |
|---|---|
| PubChem CID | 839935 |
| Molecular Formula | C11H14Cl3N3OS |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-pyrimidin-4-ylsulfanylethyl]propanamide |
| SMILES | CC(C)(C)C(=O)N[C@H](Sc1ccncn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H14Cl3N3OS/c1-10(2,3)8(18)17-9(11(12,13)14)19-7-4-5-15-6-16-7/h4-6,9H,1-3H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | XUDXPPUNNVWLHL-SECBINFHSA-N |
| XLogP | 3.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|