C18H28N2O2 — CID 83993524
methyl 2-[5-(benzylamino)-1-propylpiperidin-3-yl]acetate (PubChem CID 83993524) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is methyl 2-[5-(benzylamino)-1-propylpiperidin-3-yl]acetate.
| Compound Name | methyl 2-[5-(benzylamino)-1-propylpiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 83993524 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | methyl 2-[5-(benzylamino)-1-propylpiperidin-3-yl]acetate |
| SMILES | CCCN1CC(CC(=O)OC)CC(NCc2ccccc2)C1 |
| InChI | InChI=1S/C18H28N2O2/c1-3-9-20-13-16(11-18(21)22-2)10-17(14-20)19-12-15-7-5-4-6-8-15/h4-8,16-17,19H,3,9-14H2,1-2H3 |
| InChIKey | ZTXVAEHGGJQEIZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |