C13H27N3O2 — CID 83994797
methyl 1-(2-aminoethyl)-5-(2-methylpropylamino)piperidine-3-carboxylate (PubChem CID 83994797) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is methyl 1-(2-aminoethyl)-5-(2-methylpropylamino)piperidine-3-carboxylate.
| Compound Name | methyl 1-(2-aminoethyl)-5-(2-methylpropylamino)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 83994797 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | methyl 1-(2-aminoethyl)-5-(2-methylpropylamino)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CC(NCC(C)C)CN(CCN)C1 |
| InChI | InChI=1S/C13H27N3O2/c1-10(2)7-15-12-6-11(13(17)18-3)8-16(9-12)5-4-14/h10-12,15H,4-9,14H2,1-3H3 |
| InChIKey | MNUQLDUHIZSBFL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |