C10H8FNOS2 — CID 839955
(2-fluorophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone (PubChem CID 839955) has the molecular formula C10H8FNOS2 and a molecular weight of 241.31 g/mol. Its IUPAC name is (2-fluorophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone.
| Compound Name | (2-fluorophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 839955 |
| Molecular Formula | C10H8FNOS2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | (2-fluorophenyl)-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCSC1=S |
| InChI | InChI=1S/C10H8FNOS2/c11-8-4-2-1-3-7(8)9(13)12-5-6-15-10(12)14/h1-4H,5-6H2 |
| InChIKey | YNZADQOZXVTAQG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|