C17H30N2O3 — CID 83998555
1-butanoyl-5-(cyclohexylmethylamino)piperidine-3-carboxylic acid (PubChem CID 83998555) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-butanoyl-5-(cyclohexylmethylamino)piperidine-3-carboxylic acid.
| Compound Name | 1-butanoyl-5-(cyclohexylmethylamino)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83998555 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-butanoyl-5-(cyclohexylmethylamino)piperidine-3-carboxylic acid |
| SMILES | CCCC(=O)N1CC(NCC2CCCCC2)CC(C(=O)O)C1 |
| InChI | InChI=1S/C17H30N2O3/c1-2-6-16(20)19-11-14(17(21)22)9-15(12-19)18-10-13-7-4-3-5-8-13/h13-15,18H,2-12H2,1H3,(H,21,22) |
| InChIKey | UZQBXFABAPGMIZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |