C20H32N2O — CID 83998607
N-(cyclohexylmethyl)-1-(3-methoxyphenyl)-5-methylpiperidin-3-amine (PubChem CID 83998607) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-(3-methoxyphenyl)-5-methylpiperidin-3-amine.
| Compound Name | N-(cyclohexylmethyl)-1-(3-methoxyphenyl)-5-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 83998607 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | N-(cyclohexylmethyl)-1-(3-methoxyphenyl)-5-methylpiperidin-3-amine |
| SMILES | COc1cccc(N2CC(C)CC(NCC3CCCCC3)C2)c1 |
| InChI | InChI=1S/C20H32N2O/c1-16-11-18(21-13-17-7-4-3-5-8-17)15-22(14-16)19-9-6-10-20(12-19)23-2/h6,9-10,12,16-18,21H,3-5,7-8,11,13-15H2,1-2H3 |
| InChIKey | PVTNZZMUDSXSSW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |