C20H32N2 — CID 83999044
N-cyclohexyl-1-ethyl-5-(3-methylphenyl)piperidin-3-amine (PubChem CID 83999044) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is N-cyclohexyl-1-ethyl-5-(3-methylphenyl)piperidin-3-amine.
| Compound Name | N-cyclohexyl-1-ethyl-5-(3-methylphenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 83999044 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | N-cyclohexyl-1-ethyl-5-(3-methylphenyl)piperidin-3-amine |
| SMILES | CCN1CC(NC2CCCCC2)CC(c2cccc(C)c2)C1 |
| InChI | InChI=1S/C20H32N2/c1-3-22-14-18(17-9-7-8-16(2)12-17)13-20(15-22)21-19-10-5-4-6-11-19/h7-9,12,18-21H,3-6,10-11,13-15H2,1-2H3 |
| InChIKey | PIUUWEGHNYWYBG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |