About N,N-dipropyl-1,3-benzodioxole-5-carboxamide
N,N-dipropyl-1,3-benzodioxole-5-carboxamide (PubChem CID 840102) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is N,N-dipropyl-1,3-benzodioxole-5-carboxamide.
Molecular Properties
| Compound Name | N,N-dipropyl-1,3-benzodioxole-5-carboxamide |
| PubChem CID | 840102 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N,N-dipropyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19NO3/c1-3-7-15(8-4-2)14(16)11-5-6-12-13(9-11)18-10-17-12/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | AUNFLNYQIQZFNC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dipropyl-1,3-benzodioxole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropyl-1,3-benzodioxole-5-carboxamide?
The IUPAC name of N,N-dipropyl-1,3-benzodioxole-5-carboxamide (CID 840102) is N,N-dipropyl-1,3-benzodioxole-5-carboxamide.
What is the SMILES notation for N,N-dipropyl-1,3-benzodioxole-5-carboxamide?
The canonical SMILES for N,N-dipropyl-1,3-benzodioxole-5-carboxamide is CCCN(CCC)C(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of N,N-dipropyl-1,3-benzodioxole-5-carboxamide?
The InChIKey is AUNFLNYQIQZFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-3-7-15(8-4-2)14(16)11-5-6-12-13(9-11)18-10-17-12/h5-6,9H,3-4,7-8,10H2,1-2H3.
What are the key properties of N,N-dipropyl-1,3-benzodioxole-5-carboxamide?
N,N-dipropyl-1,3-benzodioxole-5-carboxamide has a molecular weight of 249.31 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropyl-1,3-benzodioxole-5-carboxamide is sourced from PubChem (CID 840102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).