About N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide
N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 840140) has the molecular formula C14H13F3N4OS
and a molecular weight of 342.35 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
Molecular Properties
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| PubChem CID | 840140 |
| Molecular Formula | C14H13F3N4OS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1sc(NC(=O)Cn2nc(C(F)(F)F)cc2C)c(C#N)c1C |
| InChI | InChI=1S/C14H13F3N4OS/c1-7-4-11(14(15,16)17)20-21(7)6-12(22)19-13-10(5-18)8(2)9(3)23-13/h4H,6H2,1-3H3,(H,19,22) |
| InChIKey | HPUMGDRNJOHAPV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The IUPAC name of N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (CID 840140) is N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
What is the SMILES notation for N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The canonical SMILES for N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide is Cc1sc(NC(=O)Cn2nc(C(F)(F)F)cc2C)c(C#N)c1C.
What is the InChIKey of N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide?
The InChIKey is HPUMGDRNJOHAPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N4OS/c1-7-4-11(14(15,16)17)20-21(7)6-12(22)19-13-10(5-18)8(2)9(3)23-13/h4H,6H2,1-3H3,(H,19,22).
What are the key properties of N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide?
N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide has a molecular weight of 342.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4,5-dimethylthiophen-2-yl)-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide is sourced from PubChem (CID 840140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).