About (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide
(4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide (PubChem CID 840171) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide.
Molecular Properties
| Compound Name | (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| PubChem CID | 840171 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| SMILES | C[C@H]1CCS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H12O2S/c1-8-6-7-13(11,12)10-5-3-2-4-9(8)10/h2-5,8H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | RPAVCRAYQMOMIE-QMMMGPOBSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The IUPAC name of (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide (CID 840171) is (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide.
What is the SMILES notation for (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The canonical SMILES for (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide is C[C@H]1CCS(=O)(=O)c2ccccc21.
What is the InChIKey of (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide?
The InChIKey is RPAVCRAYQMOMIE-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H12O2S/c1-8-6-7-13(11,12)10-5-3-2-4-9(8)10/h2-5,8H,6-7H2,1H3/t8-/m0/s1.
What are the key properties of (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide?
(4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide has a molecular weight of 196.27 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methyl-3,4-dihydro-2H-thiochromene 1,1-dioxide is sourced from PubChem (CID 840171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).