About dicyclohexylmethanone
dicyclohexylmethanone (PubChem CID 8403) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is dicyclohexylmethanone.
Molecular Properties
| Compound Name | dicyclohexylmethanone |
| PubChem CID | 8403 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | dicyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H22O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | TWXWPPKDQOWNSX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dicyclohexylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylmethanone?
The IUPAC name of dicyclohexylmethanone (CID 8403) is dicyclohexylmethanone.
What is the SMILES notation for dicyclohexylmethanone?
The canonical SMILES for dicyclohexylmethanone is O=C(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexylmethanone?
The InChIKey is TWXWPPKDQOWNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2.
What are the key properties of dicyclohexylmethanone?
dicyclohexylmethanone has a molecular weight of 194.32 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylmethanone is sourced from PubChem (CID 8403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).