About 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide
2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 840305) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
Molecular Properties
| Compound Name | 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| PubChem CID | 840305 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C12H12N2O3/c1-8-7-11(14-17-8)13-12(15)9-5-3-4-6-10(9)16-2/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | CZRFSOMAFPCTTN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
The IUPAC name of 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide (CID 840305) is 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
What is the SMILES notation for 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
The canonical SMILES for 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide is COc1ccccc1C(=O)Nc1cc(C)on1.
What is the InChIKey of 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
The InChIKey is CZRFSOMAFPCTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-8-7-11(14-17-8)13-12(15)9-5-3-4-6-10(9)16-2/h3-7H,1-2H3,(H,13,14,15).
What are the key properties of 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide?
2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide has a molecular weight of 232.24 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide is sourced from PubChem (CID 840305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).