About 3,6-dibromoquinoline
3,6-dibromoquinoline (PubChem CID 840332) has the molecular formula C9H5Br2N
and a molecular weight of 286.95 g/mol. Its IUPAC name is 3,6-dibromoquinoline.
Molecular Properties
| Compound Name | 3,6-dibromoquinoline |
| PubChem CID | 840332 |
| Molecular Formula | C9H5Br2N |
| Molecular Weight | 286.95 g/mol |
| Exact Mass | 284.88 |
| IUPAC Name | 3,6-dibromoquinoline |
| SMILES | Brc1ccc2ncc(Br)cc2c1 |
| InChI | InChI=1S/C9H5Br2N/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-5H |
| InChIKey | CYLMMNPZLQGNEW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dibromoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromoquinoline?
The IUPAC name of 3,6-dibromoquinoline (CID 840332) is 3,6-dibromoquinoline.
What is the SMILES notation for 3,6-dibromoquinoline?
The canonical SMILES for 3,6-dibromoquinoline is Brc1ccc2ncc(Br)cc2c1.
What is the InChIKey of 3,6-dibromoquinoline?
The InChIKey is CYLMMNPZLQGNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2N/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-5H.
What are the key properties of 3,6-dibromoquinoline?
3,6-dibromoquinoline has a molecular weight of 286.95 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromoquinoline is sourced from PubChem (CID 840332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).