About isoquinoline
isoquinoline (PubChem CID 8405) has the molecular formula C9H7N
and a molecular weight of 129.16 g/mol. Its IUPAC name is isoquinoline.
Molecular Properties
| Compound Name | isoquinoline |
| PubChem CID | 8405 |
| Molecular Formula | C9H7N |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | isoquinoline |
| SMILES | c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-7H |
| InChIKey | AWJUIBRHMBBTKR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline?
The IUPAC name of isoquinoline (CID 8405) is isoquinoline.
What is the SMILES notation for isoquinoline?
The canonical SMILES for isoquinoline is c1ccc2cnccc2c1.
What is the InChIKey of isoquinoline?
The InChIKey is AWJUIBRHMBBTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-7H.
What are the key properties of isoquinoline?
isoquinoline has a molecular weight of 129.16 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline is sourced from PubChem (CID 8405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).