About 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine
3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine (PubChem CID 840781) has the molecular formula C11H13N2S+
and a molecular weight of 205.31 g/mol. Its IUPAC name is 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine.
Molecular Properties
| Compound Name | 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine |
| PubChem CID | 840781 |
| Molecular Formula | C11H13N2S+ |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine |
| SMILES | Cc1csc(Nc2ccccc2)[n+]1C |
| InChI | InChI=1S/C11H12N2S/c1-9-8-14-11(13(9)2)12-10-6-4-3-5-7-10/h3-8H,1-2H3/p+1 |
| InChIKey | DHCNMNPNNXRRBJ-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine?
The IUPAC name of 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine (CID 840781) is 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine.
What is the SMILES notation for 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine?
The canonical SMILES for 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine is Cc1csc(Nc2ccccc2)[n+]1C.
What is the InChIKey of 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine?
The InChIKey is DHCNMNPNNXRRBJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H12N2S/c1-9-8-14-11(13(9)2)12-10-6-4-3-5-7-10/h3-8H,1-2H3/p+1.
What are the key properties of 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine?
3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine has a molecular weight of 205.31 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-N-phenyl-1,3-thiazol-3-ium-2-amine is sourced from PubChem (CID 840781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).