About (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one
(E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one (PubChem CID 841158) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one |
| PubChem CID | 841158 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/Nc2ccc(C)cn2)cc1OC |
| InChI | InChI=1S/C17H18N2O3/c1-12-4-7-17(19-11-12)18-9-8-14(20)13-5-6-15(21-2)16(10-13)22-3/h4-11H,1-3H3,(H,18,19)/b9-8+ |
| InChIKey | PIFLDHHUVGCABF-CMDGGOBGSA-N |
| XLogP | 3.22 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one?
The IUPAC name of (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one (CID 841158) is (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one.
What is the SMILES notation for (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one?
The canonical SMILES for (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one is COc1ccc(C(=O)/C=C/Nc2ccc(C)cn2)cc1OC.
What is the InChIKey of (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one?
The InChIKey is PIFLDHHUVGCABF-CMDGGOBGSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-12-4-7-17(19-11-12)18-9-8-14(20)13-5-6-15(21-2)16(10-13)22-3/h4-11H,1-3H3,(H,18,19)/b9-8+.
What are the key properties of (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one?
(E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one has a molecular weight of 298.34 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3,4-dimethoxyphenyl)-3-[(5-methyl-2-pyridinyl)amino]prop-2-en-1-one is sourced from PubChem (CID 841158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).