About 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide
1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide (PubChem CID 841518) has the molecular formula C10H12N4O2
and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide |
| PubChem CID | 841518 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cc(C)on2)cn1 |
| InChI | InChI=1S/C10H12N4O2/c1-3-14-6-8(5-11-14)10(15)12-9-4-7(2)16-13-9/h4-6H,3H2,1-2H3,(H,12,13,15) |
| InChIKey | BOPLDFNLSKYJSN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide?
The IUPAC name of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide (CID 841518) is 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide.
What is the SMILES notation for 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide?
The canonical SMILES for 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide is CCn1cc(C(=O)Nc2cc(C)on2)cn1.
What is the InChIKey of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide?
The InChIKey is BOPLDFNLSKYJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2/c1-3-14-6-8(5-11-14)10(15)12-9-4-7(2)16-13-9/h4-6H,3H2,1-2H3,(H,12,13,15).
What are the key properties of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide?
1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide has a molecular weight of 220.23 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)pyrazole-4-carboxamide is sourced from PubChem (CID 841518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).