About 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide
1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide (PubChem CID 841688) has the molecular formula C10H11N5O4
and a molecular weight of 265.23 g/mol. Its IUPAC name is 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide |
| PubChem CID | 841688 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C10H11N5O4/c1-3-14-9(7(5-11-14)15(17)18)10(16)12-8-4-6(2)19-13-8/h4-5H,3H2,1-2H3,(H,12,13,16) |
| InChIKey | CUZZXRASKFRWMB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide?
The IUPAC name of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide (CID 841688) is 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide.
What is the SMILES notation for 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide?
The canonical SMILES for 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide is CCn1ncc([N+](=O)[O-])c1C(=O)Nc1cc(C)on1.
What is the InChIKey of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide?
The InChIKey is CUZZXRASKFRWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O4/c1-3-14-9(7(5-11-14)15(17)18)10(16)12-8-4-6(2)19-13-8/h4-5H,3H2,1-2H3,(H,12,13,16).
What are the key properties of 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide?
1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide has a molecular weight of 265.23 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(5-methyl-1,2-oxazol-3-yl)-4-nitropyrazole-5-carboxamide is sourced from PubChem (CID 841688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).