About Scoparone
Scoparone (PubChem CID 8417) has the molecular formula C11H10O4
and a molecular weight of 206.19 g/mol. Its IUPAC name is 6,7-dimethoxychromen-2-one.
Molecular Properties
| Compound Name | Scoparone |
| PubChem CID | 8417 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 6,7-dimethoxychromen-2-one |
| SMILES | COC1=C(C=C2C(=C1)C=CC(=O)O2)OC |
| InChI | InChI=1S/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3 |
| InChIKey | GUAFOGOEJLSQBT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 274 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze Scoparone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Scoparone?
The IUPAC name of Scoparone (CID 8417) is 6,7-dimethoxychromen-2-one.
What is the SMILES notation for Scoparone?
The canonical SMILES for Scoparone is COC1=C(C=C2C(=C1)C=CC(=O)O2)OC.
What is the InChIKey of Scoparone?
The InChIKey is GUAFOGOEJLSQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3.
What are the key properties of Scoparone?
Scoparone has a molecular weight of 206.19 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Scoparone is sourced from PubChem (CID 8417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).