About N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide
N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide (PubChem CID 841949) has the molecular formula C10H9Cl2NO3S
and a molecular weight of 294.16 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide.
Molecular Properties
| Compound Name | N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide |
| PubChem CID | 841949 |
| Molecular Formula | C10H9Cl2NO3S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide |
| SMILES | CC(=O)NC(=C(Cl)Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9Cl2NO3S/c1-7(14)13-10(9(11)12)17(15,16)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
| InChIKey | SMVUYUWPKIKFKE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide?
The IUPAC name of N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide (CID 841949) is N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide.
What is the SMILES notation for N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide?
The canonical SMILES for N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide is CC(=O)NC(=C(Cl)Cl)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide?
The InChIKey is SMVUYUWPKIKFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO3S/c1-7(14)13-10(9(11)12)17(15,16)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14).
What are the key properties of N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide?
N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide has a molecular weight of 294.16 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(benzenesulfonyl)-2,2-dichloroethenyl]acetamide is sourced from PubChem (CID 841949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).