C14H17F4NO2 — CID 842473
N-propan-2-yl-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 842473) has the molecular formula C14H17F4NO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is N-propan-2-yl-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-propan-2-yl-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 842473 |
| Molecular Formula | C14H17F4NO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-propan-2-yl-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | CC(C)NC(=O)c1ccc(COCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C14H17F4NO2/c1-9(2)19-12(20)11-5-3-10(4-6-11)7-21-8-14(17,18)13(15)16/h3-6,9,13H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | PMQMUWWEPXEURZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|