About 2-benzyl-4-chlorophenol
2-benzyl-4-chlorophenol (PubChem CID 8425) has the molecular formula C13H11ClO
and a molecular weight of 218.68 g/mol. Its IUPAC name is 2-benzyl-4-chlorophenol.
Molecular Properties
| Compound Name | 2-benzyl-4-chlorophenol |
| PubChem CID | 8425 |
| Molecular Formula | C13H11ClO |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-benzyl-4-chlorophenol |
| SMILES | Oc1ccc(Cl)cc1Cc1ccccc1 |
| InChI | InChI=1S/C13H11ClO/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10/h1-7,9,15H,8H2 |
| InChIKey | NCKMMSIFQUPKCK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzyl-4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-chlorophenol?
The IUPAC name of 2-benzyl-4-chlorophenol (CID 8425) is 2-benzyl-4-chlorophenol.
What is the SMILES notation for 2-benzyl-4-chlorophenol?
The canonical SMILES for 2-benzyl-4-chlorophenol is Oc1ccc(Cl)cc1Cc1ccccc1.
What is the InChIKey of 2-benzyl-4-chlorophenol?
The InChIKey is NCKMMSIFQUPKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClO/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10/h1-7,9,15H,8H2.
What are the key properties of 2-benzyl-4-chlorophenol?
2-benzyl-4-chlorophenol has a molecular weight of 218.68 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-chlorophenol is sourced from PubChem (CID 8425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).