C9H12ClN5S — CID 842843
3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 842843) has the molecular formula C9H12ClN5S and a molecular weight of 257.75 g/mol. Its IUPAC name is 3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 842843 |
| Molecular Formula | C9H12ClN5S |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-(4-chloro-1,3-dimethylpyrazol-5-yl)-4-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(-c2c(Cl)c(C)nn2C)n[nH]c1=S |
| InChI | InChI=1S/C9H12ClN5S/c1-4-15-8(11-12-9(15)16)7-6(10)5(2)13-14(7)3/h4H2,1-3H3,(H,12,16) |
| InChIKey | SLVVIFARDRUWFW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|