About 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea
1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea (PubChem CID 842928) has the molecular formula C14H16ClN5OS
and a molecular weight of 337.84 g/mol. Its IUPAC name is 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea.
Molecular Properties
| Compound Name | 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea |
| PubChem CID | 842928 |
| Molecular Formula | C14H16ClN5OS |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea |
| SMILES | Cc1nn(C)c(C(=O)NNC(=S)NCc2ccccc2)c1Cl |
| InChI | InChI=1S/C14H16ClN5OS/c1-9-11(15)12(20(2)19-9)13(21)17-18-14(22)16-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,17,21)(H2,16,18,22) |
| InChIKey | HXNIOASGZNEFKP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea?
The IUPAC name of 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea (CID 842928) is 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea.
What is the SMILES notation for 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea?
The canonical SMILES for 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea is Cc1nn(C)c(C(=O)NNC(=S)NCc2ccccc2)c1Cl.
What is the InChIKey of 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea?
The InChIKey is HXNIOASGZNEFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN5OS/c1-9-11(15)12(20(2)19-9)13(21)17-18-14(22)16-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,17,21)(H2,16,18,22).
What are the key properties of 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea?
1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea has a molecular weight of 337.84 g/mol, XLogP of 1.69, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]thiourea is sourced from PubChem (CID 842928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).