About N-(4-anilinophenyl)-3,4-dimethylbenzamide
N-(4-anilinophenyl)-3,4-dimethylbenzamide (PubChem CID 843096) has the molecular formula C21H20N2O
and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(4-anilinophenyl)-3,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(4-anilinophenyl)-3,4-dimethylbenzamide |
| PubChem CID | 843096 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(4-anilinophenyl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Nc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C21H20N2O/c1-15-8-9-17(14-16(15)2)21(24)23-20-12-10-19(11-13-20)22-18-6-4-3-5-7-18/h3-14,22H,1-2H3,(H,23,24) |
| InChIKey | SGHRTBGMKQDAQI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-anilinophenyl)-3,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-anilinophenyl)-3,4-dimethylbenzamide?
The IUPAC name of N-(4-anilinophenyl)-3,4-dimethylbenzamide (CID 843096) is N-(4-anilinophenyl)-3,4-dimethylbenzamide.
What is the SMILES notation for N-(4-anilinophenyl)-3,4-dimethylbenzamide?
The canonical SMILES for N-(4-anilinophenyl)-3,4-dimethylbenzamide is Cc1ccc(C(=O)Nc2ccc(Nc3ccccc3)cc2)cc1C.
What is the InChIKey of N-(4-anilinophenyl)-3,4-dimethylbenzamide?
The InChIKey is SGHRTBGMKQDAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O/c1-15-8-9-17(14-16(15)2)21(24)23-20-12-10-19(11-13-20)22-18-6-4-3-5-7-18/h3-14,22H,1-2H3,(H,23,24).
What are the key properties of N-(4-anilinophenyl)-3,4-dimethylbenzamide?
N-(4-anilinophenyl)-3,4-dimethylbenzamide has a molecular weight of 316.40 g/mol, XLogP of 5.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-anilinophenyl)-3,4-dimethylbenzamide is sourced from PubChem (CID 843096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).