About ethyl piperazine-1-carboxylate
ethyl piperazine-1-carboxylate (PubChem CID 8431) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is ethyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl piperazine-1-carboxylate |
| PubChem CID | 8431 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | ethyl piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCNCC1 |
| InChI | InChI=1S/C7H14N2O2/c1-2-11-7(10)9-5-3-8-4-6-9/h8H,2-6H2,1H3 |
| InChIKey | LNOQURRKNJKKBU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl piperazine-1-carboxylate?
The IUPAC name of ethyl piperazine-1-carboxylate (CID 8431) is ethyl piperazine-1-carboxylate.
What is the SMILES notation for ethyl piperazine-1-carboxylate?
The canonical SMILES for ethyl piperazine-1-carboxylate is CCOC(=O)N1CCNCC1.
What is the InChIKey of ethyl piperazine-1-carboxylate?
The InChIKey is LNOQURRKNJKKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-2-11-7(10)9-5-3-8-4-6-9/h8H,2-6H2,1H3.
What are the key properties of ethyl piperazine-1-carboxylate?
ethyl piperazine-1-carboxylate has a molecular weight of 158.20 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl piperazine-1-carboxylate is sourced from PubChem (CID 8431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).